C28H28N4O3S2 — CID 46304930
N-[4-(2-phenylethylsulfamoyl)phenyl]-2-(6-phenylpyrimidin-4-yl)sulfanylbutanamide (PubChem CID 46304930) has the molecular formula C28H28N4O3S2 and a molecular weight of 532.69 g/mol. Its IUPAC name is N-[4-(2-phenylethylsulfamoyl)phenyl]-2-(6-phenylpyrimidin-4-yl)sulfanylbutanamide.
| Compound Name | N-[4-(2-phenylethylsulfamoyl)phenyl]-2-(6-phenylpyrimidin-4-yl)sulfanylbutanamide |
|---|---|
| PubChem CID | 46304930 |
| Molecular Formula | C28H28N4O3S2 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.16 |
| IUPAC Name | N-[4-(2-phenylethylsulfamoyl)phenyl]-2-(6-phenylpyrimidin-4-yl)sulfanylbutanamide |
| SMILES | CCC(Sc1cc(-c2ccccc2)ncn1)C(=O)Nc1ccc(S(=O)(=O)NCCc2ccccc2)cc1 |
| InChI | InChI=1S/C28H28N4O3S2/c1-2-26(36-27-19-25(29-20-30-27)22-11-7-4-8-12-22)28(33)32-23-13-15-24(16-14-23)37(34,35)31-18-17-21-9-5-3-6-10-21/h3-16,19-20,26,31H,2,17-18H2,1H3,(H,32,33) |
| InChIKey | BVJUJYUGZDXBFL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |