C25H29N3OS — CID 46305120
N-(4-butylphenyl)-2-(2-methyl-6-phenylpyrimidin-4-yl)sulfanylbutanamide (PubChem CID 46305120) has the molecular formula C25H29N3OS and a molecular weight of 419.59 g/mol. Its IUPAC name is N-(4-butylphenyl)-2-(2-methyl-6-phenylpyrimidin-4-yl)sulfanylbutanamide.
| Compound Name | N-(4-butylphenyl)-2-(2-methyl-6-phenylpyrimidin-4-yl)sulfanylbutanamide |
|---|---|
| PubChem CID | 46305120 |
| Molecular Formula | C25H29N3OS |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | N-(4-butylphenyl)-2-(2-methyl-6-phenylpyrimidin-4-yl)sulfanylbutanamide |
| SMILES | CCCCc1ccc(NC(=O)C(CC)Sc2cc(-c3ccccc3)nc(C)n2)cc1 |
| InChI | InChI=1S/C25H29N3OS/c1-4-6-10-19-13-15-21(16-14-19)28-25(29)23(5-2)30-24-17-22(26-18(3)27-24)20-11-8-7-9-12-20/h7-9,11-17,23H,4-6,10H2,1-3H3,(H,28,29) |
| InChIKey | JMNBDQFZKKBIEF-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |