C13H10Cl4OS2 — CID 134876108
S-methyl (2Z,4Z)-2,3,4,5-tetrachloro-5-(4-methylphenyl)sulfanylpenta-2,4-dienethioate (PubChem CID 134876108) has the molecular formula C13H10Cl4OS2 and a molecular weight of 388.17 g/mol. Its IUPAC name is S-methyl (2Z,4Z)-2,3,4,5-tetrachloro-5-(4-methylphenyl)sulfanylpenta-2,4-dienethioate.
| Compound Name | S-methyl (2Z,4Z)-2,3,4,5-tetrachloro-5-(4-methylphenyl)sulfanylpenta-2,4-dienethioate |
|---|---|
| PubChem CID | 134876108 |
| Molecular Formula | C13H10Cl4OS2 |
| Molecular Weight | 388.17 g/mol |
| Exact Mass | 385.89 |
| IUPAC Name | S-methyl (2Z,4Z)-2,3,4,5-tetrachloro-5-(4-methylphenyl)sulfanylpenta-2,4-dienethioate |
| SMILES | CSC(=O)/C(Cl)=C(Cl)\C(Cl)=C(\Cl)Sc1ccc(C)cc1 |
| InChI | InChI=1S/C13H10Cl4OS2/c1-7-3-5-8(6-4-7)20-12(17)10(15)9(14)11(16)13(18)19-2/h3-6H,1-2H3/b11-9-,12-10+ |
| InChIKey | DQAUNGGSBSSQTC-DSOJMZEYSA-N |
| XLogP | 6.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.17 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|