C12H8Cl4OS — CID 134893816
(2Z,4E)-2,3,4,5-tetrachloro-5-(4-methylphenyl)sulfanylpenta-2,4-dienal (PubChem CID 134893816) has the molecular formula C12H8Cl4OS and a molecular weight of 342.07 g/mol. Its IUPAC name is (2Z,4E)-2,3,4,5-tetrachloro-5-(4-methylphenyl)sulfanylpenta-2,4-dienal.
| Compound Name | (2Z,4E)-2,3,4,5-tetrachloro-5-(4-methylphenyl)sulfanylpenta-2,4-dienal |
|---|---|
| PubChem CID | 134893816 |
| Molecular Formula | C12H8Cl4OS |
| Molecular Weight | 342.07 g/mol |
| Exact Mass | 339.90 |
| IUPAC Name | (2Z,4E)-2,3,4,5-tetrachloro-5-(4-methylphenyl)sulfanylpenta-2,4-dienal |
| SMILES | Cc1ccc(S/C(Cl)=C(Cl)/C(Cl)=C(/Cl)C=O)cc1 |
| InChI | InChI=1S/C12H8Cl4OS/c1-7-2-4-8(5-3-7)18-12(16)11(15)10(14)9(13)6-17/h2-6H,1H3/b10-9-,12-11- |
| InChIKey | UEHPDLFZKSUKHY-BASFJDSNSA-N |
| XLogP | 5.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.07 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|