C27H38N2Pd — CID 87874969
5-N,6-N-diphenylpentadecane-5,6-diimine;palladium (PubChem CID 87874969) has the molecular formula C27H38N2Pd and a molecular weight of 497.04 g/mol. Its IUPAC name is 5-N,6-N-diphenylpentadecane-5,6-diimine;palladium.
| Compound Name | 5-N,6-N-diphenylpentadecane-5,6-diimine;palladium |
|---|---|
| PubChem CID | 87874969 |
| Molecular Formula | C27H38N2Pd |
| Molecular Weight | 497.04 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 5-N,6-N-diphenylpentadecane-5,6-diimine;palladium |
| SMILES | CCCCCCCCCC(=N\c1ccccc1)/C(CCCC)=N/c1ccccc1.[Pd] |
| InChI | InChI=1S/C27H38N2.Pd/c1-3-5-7-8-9-10-17-23-27(29-25-20-15-12-16-21-25)26(22-6-4-2)28-24-18-13-11-14-19-24;/h11-16,18-21H,3-10,17,22-23H2,1-2H3;/b28-26+,29-27+; |
| InChIKey | BQEVEQHIXVTSNF-JBQZZDHSSA-N |
| XLogP | 8.86 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.04 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|