C22H28N2Pd — CID 87876539
3-N,4-N-diphenyldecane-3,4-diimine;palladium (PubChem CID 87876539) has the molecular formula C22H28N2Pd and a molecular weight of 426.90 g/mol. Its IUPAC name is 3-N,4-N-diphenyldecane-3,4-diimine;palladium.
| Compound Name | 3-N,4-N-diphenyldecane-3,4-diimine;palladium |
|---|---|
| PubChem CID | 87876539 |
| Molecular Formula | C22H28N2Pd |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 3-N,4-N-diphenyldecane-3,4-diimine;palladium |
| SMILES | CCCCCCC(=N\c1ccccc1)/C(CC)=N/c1ccccc1.[Pd] |
| InChI | InChI=1S/C22H28N2.Pd/c1-3-5-6-13-18-22(24-20-16-11-8-12-17-20)21(4-2)23-19-14-9-7-10-15-19;/h7-12,14-17H,3-6,13,18H2,1-2H3;/b23-21+,24-22+; |
| InChIKey | UIPDCHXKNFDTIG-BAYNMDCWSA-N |
| XLogP | 6.91 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|