C32H48N2Pd — CID 87911026
6-N-(3,4-dipentylphenyl)-5-N-phenyldecane-5,6-diimine;palladium (PubChem CID 87911026) has the molecular formula C32H48N2Pd and a molecular weight of 567.17 g/mol. Its IUPAC name is 6-N-(3,4-dipentylphenyl)-5-N-phenyldecane-5,6-diimine;palladium.
| Compound Name | 6-N-(3,4-dipentylphenyl)-5-N-phenyldecane-5,6-diimine;palladium |
|---|---|
| PubChem CID | 87911026 |
| Molecular Formula | C32H48N2Pd |
| Molecular Weight | 567.17 g/mol |
| Exact Mass | 566.29 |
| IUPAC Name | 6-N-(3,4-dipentylphenyl)-5-N-phenyldecane-5,6-diimine;palladium |
| SMILES | CCCCCc1ccc(/N=C(CCCC)/C(CCCC)=N/c2ccccc2)cc1CCCCC.[Pd] |
| InChI | InChI=1S/C32H48N2.Pd/c1-5-9-14-18-27-24-25-30(26-28(27)19-15-10-6-2)34-32(23-12-8-4)31(22-11-7-3)33-29-20-16-13-17-21-29;/h13,16-17,20-21,24-26H,5-12,14-15,18-19,22-23H2,1-4H3;/b33-31+,34-32+; |
| InChIKey | XFNZWVZKJOMCKD-KQOFJJDPSA-N |
| XLogP | 10.38 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.17 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|