C39H62N2 — CID 21033263
5-N,6-N-bis(3,4-dibutylphenyl)undecane-5,6-diimine (PubChem CID 21033263) has the molecular formula C39H62N2 and a molecular weight of 558.94 g/mol. Its IUPAC name is 5-N,6-N-bis(3,4-dibutylphenyl)undecane-5,6-diimine.
| Compound Name | 5-N,6-N-bis(3,4-dibutylphenyl)undecane-5,6-diimine |
|---|---|
| PubChem CID | 21033263 |
| Molecular Formula | C39H62N2 |
| Molecular Weight | 558.94 g/mol |
| Exact Mass | 558.49 |
| IUPAC Name | 5-N,6-N-bis(3,4-dibutylphenyl)undecane-5,6-diimine |
| SMILES | CCCCCC(=N\c1ccc(CCCC)c(CCCC)c1)/C(CCCC)=N/c1ccc(CCCC)c(CCCC)c1 |
| InChI | InChI=1S/C39H62N2/c1-7-13-19-25-39(41-37-29-27-33(21-15-9-3)35(31-37)23-17-11-5)38(24-18-12-6)40-36-28-26-32(20-14-8-2)34(30-36)22-16-10-4/h26-31H,7-25H2,1-6H3/b40-38+,41-39+ |
| InChIKey | FBEJVUGNSXITGL-QYGUTFKISA-N |
| XLogP | 12.67 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.94 |
| LogP ≤ 5 | 12.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|