C34H52N2Ni — CID 87874695
5-N,6-N-bis(3,4-dipropylphenyl)decane-5,6-diimine;nickel (PubChem CID 87874695) has the molecular formula C34H52N2Ni and a molecular weight of 547.50 g/mol. Its IUPAC name is 5-N,6-N-bis(3,4-dipropylphenyl)decane-5,6-diimine;nickel.
| Compound Name | 5-N,6-N-bis(3,4-dipropylphenyl)decane-5,6-diimine;nickel |
|---|---|
| PubChem CID | 87874695 |
| Molecular Formula | C34H52N2Ni |
| Molecular Weight | 547.50 g/mol |
| Exact Mass | 546.35 |
| IUPAC Name | 5-N,6-N-bis(3,4-dipropylphenyl)decane-5,6-diimine;nickel |
| SMILES | CCCCC(=N\c1ccc(CCC)c(CCC)c1)/C(CCCC)=N/c1ccc(CCC)c(CCC)c1.[Ni] |
| InChI | InChI=1S/C34H52N2.Ni/c1-7-13-19-33(35-31-23-21-27(15-9-3)29(25-31)17-11-5)34(20-14-8-2)36-32-24-22-28(16-10-4)30(26-32)18-12-6;/h21-26H,7-20H2,1-6H3;/b35-33+,36-34+; |
| InChIKey | OQDDERUPLRANCZ-KCINWWGPSA-N |
| XLogP | 10.72 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.50 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|