C35H54N2Pd — CID 87912016
5-N,6-N-bis(3,4-dipropylphenyl)undecane-5,6-diimine;palladium (PubChem CID 87912016) has the molecular formula C35H54N2Pd and a molecular weight of 609.25 g/mol. Its IUPAC name is 5-N,6-N-bis(3,4-dipropylphenyl)undecane-5,6-diimine;palladium.
| Compound Name | 5-N,6-N-bis(3,4-dipropylphenyl)undecane-5,6-diimine;palladium |
|---|---|
| PubChem CID | 87912016 |
| Molecular Formula | C35H54N2Pd |
| Molecular Weight | 609.25 g/mol |
| Exact Mass | 608.33 |
| IUPAC Name | 5-N,6-N-bis(3,4-dipropylphenyl)undecane-5,6-diimine;palladium |
| SMILES | CCCCCC(=N\c1ccc(CCC)c(CCC)c1)/C(CCCC)=N/c1ccc(CCC)c(CCC)c1.[Pd] |
| InChI | InChI=1S/C35H54N2.Pd/c1-7-13-15-21-35(37-33-25-23-29(17-10-4)31(27-33)19-12-6)34(20-14-8-2)36-32-24-22-28(16-9-3)30(26-32)18-11-5;/h22-27H,7-21H2,1-6H3;/b36-34+,37-35+; |
| InChIKey | SLIWEBWOLDADRW-KTLQDXEESA-N |
| XLogP | 11.11 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.25 |
| LogP ≤ 5 | 11.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|