C38H60N2Ni — CID 87875213
5-N,6-N-bis(3,4-dibutylphenyl)decane-5,6-diimine;nickel (PubChem CID 87875213) has the molecular formula C38H60N2Ni and a molecular weight of 603.61 g/mol. Its IUPAC name is 5-N,6-N-bis(3,4-dibutylphenyl)decane-5,6-diimine;nickel.
| Compound Name | 5-N,6-N-bis(3,4-dibutylphenyl)decane-5,6-diimine;nickel |
|---|---|
| PubChem CID | 87875213 |
| Molecular Formula | C38H60N2Ni |
| Molecular Weight | 603.61 g/mol |
| Exact Mass | 602.41 |
| IUPAC Name | 5-N,6-N-bis(3,4-dibutylphenyl)decane-5,6-diimine;nickel |
| SMILES | CCCCC(=N\c1ccc(CCCC)c(CCCC)c1)/C(CCCC)=N/c1ccc(CCCC)c(CCCC)c1.[Ni] |
| InChI | InChI=1S/C38H60N2.Ni/c1-7-13-19-31-25-27-35(29-33(31)21-15-9-3)39-37(23-17-11-5)38(24-18-12-6)40-36-28-26-32(20-14-8-2)34(30-36)22-16-10-4;/h25-30H,7-24H2,1-6H3;/b39-37+,40-38+; |
| InChIKey | USWSPKDLFQENCX-IJKDMPGWSA-N |
| XLogP | 12.28 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.61 |
| LogP ≤ 5 | 12.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|