C40H64N2 — CID 21033195
5-N,6-N-bis(3,4-dibutylphenyl)dodecane-5,6-diimine (PubChem CID 21033195) has the molecular formula C40H64N2 and a molecular weight of 572.97 g/mol. Its IUPAC name is 5-N,6-N-bis(3,4-dibutylphenyl)dodecane-5,6-diimine.
| Compound Name | 5-N,6-N-bis(3,4-dibutylphenyl)dodecane-5,6-diimine |
|---|---|
| PubChem CID | 21033195 |
| Molecular Formula | C40H64N2 |
| Molecular Weight | 572.97 g/mol |
| Exact Mass | 572.51 |
| IUPAC Name | 5-N,6-N-bis(3,4-dibutylphenyl)dodecane-5,6-diimine |
| SMILES | CCCCCCC(=N\c1ccc(CCCC)c(CCCC)c1)/C(CCCC)=N/c1ccc(CCCC)c(CCCC)c1 |
| InChI | InChI=1S/C40H64N2/c1-7-13-19-20-26-40(42-38-30-28-34(22-15-9-3)36(32-38)24-17-11-5)39(25-18-12-6)41-37-29-27-33(21-14-8-2)35(31-37)23-16-10-4/h27-32H,7-26H2,1-6H3/b41-39+,42-40+ |
| InChIKey | LEBWJIUBWYBSQB-LMXNTIJMSA-N |
| XLogP | 13.06 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.97 |
| LogP ≤ 5 | 13.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|