C30H44N2 — CID 21033322
3-N,4-N-bis(3,4-diethylphenyl)decane-3,4-diimine (PubChem CID 21033322) has the molecular formula C30H44N2 and a molecular weight of 432.70 g/mol. Its IUPAC name is 3-N,4-N-bis(3,4-diethylphenyl)decane-3,4-diimine.
| Compound Name | 3-N,4-N-bis(3,4-diethylphenyl)decane-3,4-diimine |
|---|---|
| PubChem CID | 21033322 |
| Molecular Formula | C30H44N2 |
| Molecular Weight | 432.70 g/mol |
| Exact Mass | 432.35 |
| IUPAC Name | 3-N,4-N-bis(3,4-diethylphenyl)decane-3,4-diimine |
| SMILES | CCCCCCC(=N\c1ccc(CC)c(CC)c1)/C(CC)=N/c1ccc(CC)c(CC)c1 |
| InChI | InChI=1S/C30H44N2/c1-7-13-14-15-16-30(32-28-20-18-24(9-3)26(11-5)22-28)29(12-6)31-27-19-17-23(8-2)25(10-4)21-27/h17-22H,7-16H2,1-6H3/b31-29+,32-30+ |
| InChIKey | PFTFXPAHFUPRIT-JWTBXLROSA-N |
| XLogP | 9.16 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.70 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|