C24H32N2Pd — CID 87874738
6-N,7-N-diphenyldodecane-6,7-diimine;palladium (PubChem CID 87874738) has the molecular formula C24H32N2Pd and a molecular weight of 454.95 g/mol. Its IUPAC name is 6-N,7-N-diphenyldodecane-6,7-diimine;palladium.
| Compound Name | 6-N,7-N-diphenyldodecane-6,7-diimine;palladium |
|---|---|
| PubChem CID | 87874738 |
| Molecular Formula | C24H32N2Pd |
| Molecular Weight | 454.95 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | 6-N,7-N-diphenyldodecane-6,7-diimine;palladium |
| SMILES | CCCCCC(=N\c1ccccc1)/C(CCCCC)=N/c1ccccc1.[Pd] |
| InChI | InChI=1S/C24H32N2.Pd/c1-3-5-9-19-23(25-21-15-11-7-12-16-21)24(20-10-6-4-2)26-22-17-13-8-14-18-22;/h7-8,11-18H,3-6,9-10,19-20H2,1-2H3;/b25-23+,26-24+; |
| InChIKey | HSBBXIVARNQRPF-MVAKMUFYSA-N |
| XLogP | 7.69 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.95 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|