C35H46N2NiO2 — CID 162040579
5-N,6-N-diphenyldodecane-5,6-diimine;4-ethyl-5-propylbenzene-1,2-diolate;nickel(2+) (PubChem CID 162040579) has the molecular formula C35H46N2NiO2 and a molecular weight of 585.46 g/mol. Its IUPAC name is 5-N,6-N-diphenyldodecane-5,6-diimine;4-ethyl-5-propylbenzene-1,2-diolate;nickel(2+).
| Compound Name | 5-N,6-N-diphenyldodecane-5,6-diimine;4-ethyl-5-propylbenzene-1,2-diolate;nickel(2+) |
|---|---|
| PubChem CID | 162040579 |
| Molecular Formula | C35H46N2NiO2 |
| Molecular Weight | 585.46 g/mol |
| Exact Mass | 584.29 |
| IUPAC Name | 5-N,6-N-diphenyldodecane-5,6-diimine;4-ethyl-5-propylbenzene-1,2-diolate;nickel(2+) |
| SMILES | CCCCCCC(=N\c1ccccc1)/C(CCCC)=N/c1ccccc1.CCCc1cc([O-])c([O-])cc1CC.[Ni+2] |
| InChI | InChI=1S/C24H32N2.C11H16O2.Ni/c1-3-5-7-14-20-24(26-22-17-12-9-13-18-22)23(19-6-4-2)25-21-15-10-8-11-16-21;1-3-5-9-7-11(13)10(12)6-8(9)4-2;/h8-13,15-18H,3-7,14,19-20H2,1-2H3;6-7,12-13H,3-5H2,1-2H3;/q;;+2/p-2/b25-23+,26-24+;; |
| InChIKey | YXFMMWSFKQUSJU-SPBSJSFYSA-L |
| XLogP | 9.04 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.46 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|