C39H54N2NiO2 — CID 162206281
5-N,6-N-diphenyltetradecane-5,6-diimine;3-ethyl-4-pentylbenzene-1,2-diolate;nickel(2+) (PubChem CID 162206281) has the molecular formula C39H54N2NiO2 and a molecular weight of 641.57 g/mol. Its IUPAC name is 5-N,6-N-diphenyltetradecane-5,6-diimine;3-ethyl-4-pentylbenzene-1,2-diolate;nickel(2+).
| Compound Name | 5-N,6-N-diphenyltetradecane-5,6-diimine;3-ethyl-4-pentylbenzene-1,2-diolate;nickel(2+) |
|---|---|
| PubChem CID | 162206281 |
| Molecular Formula | C39H54N2NiO2 |
| Molecular Weight | 641.57 g/mol |
| Exact Mass | 640.35 |
| IUPAC Name | 5-N,6-N-diphenyltetradecane-5,6-diimine;3-ethyl-4-pentylbenzene-1,2-diolate;nickel(2+) |
| SMILES | CCCCCCCCC(=N\c1ccccc1)/C(CCCC)=N/c1ccccc1.CCCCCc1ccc([O-])c([O-])c1CC.[Ni+2] |
| InChI | InChI=1S/C26H36N2.C13H20O2.Ni/c1-3-5-7-8-9-16-22-26(28-24-19-14-11-15-20-24)25(21-6-4-2)27-23-17-12-10-13-18-23;1-3-5-6-7-10-8-9-12(14)13(15)11(10)4-2;/h10-15,17-20H,3-9,16,21-22H2,1-2H3;8-9,14-15H,3-7H2,1-2H3;/q;;+2/p-2/b27-25+,28-26+;; |
| InChIKey | ZSFRTVCNYUOINY-LDLMNINZSA-L |
| XLogP | 10.60 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.57 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|