C57H90N2NiO2 — CID 158089514
5-N,6-N-bis(3,5-dipentylphenyl)dodecane-5,6-diimine;5-ethyl-3-pentylbenzene-1,2-diolate;nickel(2+) (PubChem CID 158089514) has the molecular formula C57H90N2NiO2 and a molecular weight of 894.05 g/mol. Its IUPAC name is 5-N,6-N-bis(3,5-dipentylphenyl)dodecane-5,6-diimine;5-ethyl-3-pentylbenzene-1,2-diolate;nickel(2+).
| Compound Name | 5-N,6-N-bis(3,5-dipentylphenyl)dodecane-5,6-diimine;5-ethyl-3-pentylbenzene-1,2-diolate;nickel(2+) |
|---|---|
| PubChem CID | 158089514 |
| Molecular Formula | C57H90N2NiO2 |
| Molecular Weight | 894.05 g/mol |
| Exact Mass | 892.64 |
| IUPAC Name | 5-N,6-N-bis(3,5-dipentylphenyl)dodecane-5,6-diimine;5-ethyl-3-pentylbenzene-1,2-diolate;nickel(2+) |
| SMILES | CCCCCCC(=N\c1cc(CCCCC)cc(CCCCC)c1)/C(CCCC)=N/c1cc(CCCCC)cc(CCCCC)c1.CCCCCc1cc(CC)cc([O-])c1[O-].[Ni+2] |
| InChI | InChI=1S/C44H72N2.C13H20O2.Ni/c1-7-13-19-24-30-44(46-42-35-39(27-22-16-10-4)32-40(36-42)28-23-17-11-5)43(29-18-12-6)45-41-33-37(25-20-14-8-2)31-38(34-41)26-21-15-9-3;1-3-5-6-7-11-8-10(4-2)9-12(14)13(11)15;/h31-36H,7-30H2,1-6H3;8-9,14-15H,3-7H2,1-2H3;/q;;+2/p-2/b45-43+,46-44+;; |
| InChIKey | FNXRTPABHDJLBS-KDUZSUQQSA-L |
| XLogP | 16.75 |
| TPSA | 70.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.05 |
| LogP ≤ 5 | 16.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|