C40H64N2Pd — CID 87912205
5-N,6-N-bis(3,5-dibutylphenyl)dodecane-5,6-diimine;palladium (PubChem CID 87912205) has the molecular formula C40H64N2Pd and a molecular weight of 679.39 g/mol. Its IUPAC name is 5-N,6-N-bis(3,5-dibutylphenyl)dodecane-5,6-diimine;palladium.
| Compound Name | 5-N,6-N-bis(3,5-dibutylphenyl)dodecane-5,6-diimine;palladium |
|---|---|
| PubChem CID | 87912205 |
| Molecular Formula | C40H64N2Pd |
| Molecular Weight | 679.39 g/mol |
| Exact Mass | 678.41 |
| IUPAC Name | 5-N,6-N-bis(3,5-dibutylphenyl)dodecane-5,6-diimine;palladium |
| SMILES | CCCCCCC(=N\c1cc(CCCC)cc(CCCC)c1)/C(CCCC)=N/c1cc(CCCC)cc(CCCC)c1.[Pd] |
| InChI | InChI=1S/C40H64N2.Pd/c1-7-13-19-20-26-40(42-38-31-35(23-16-10-4)28-36(32-38)24-17-11-5)39(25-18-12-6)41-37-29-33(21-14-8-2)27-34(30-37)22-15-9-3;/h27-32H,7-26H2,1-6H3;/b41-39+,42-40+; |
| InChIKey | UAZKZPXOWHLVAV-QGANLEANSA-N |
| XLogP | 13.06 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.39 |
| LogP ≤ 5 | 13.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|