C50H84N2Ni — CID 87912252
9-N,10-N-bis(3,5-dipentylphenyl)octadecane-9,10-diimine;nickel (PubChem CID 87912252) has the molecular formula C50H84N2Ni and a molecular weight of 771.93 g/mol. Its IUPAC name is 9-N,10-N-bis(3,5-dipentylphenyl)octadecane-9,10-diimine;nickel.
| Compound Name | 9-N,10-N-bis(3,5-dipentylphenyl)octadecane-9,10-diimine;nickel |
|---|---|
| PubChem CID | 87912252 |
| Molecular Formula | C50H84N2Ni |
| Molecular Weight | 771.93 g/mol |
| Exact Mass | 770.60 |
| IUPAC Name | 9-N,10-N-bis(3,5-dipentylphenyl)octadecane-9,10-diimine;nickel |
| SMILES | CCCCCCCCC(=N\c1cc(CCCCC)cc(CCCCC)c1)/C(CCCCCCCC)=N/c1cc(CCCCC)cc(CCCCC)c1.[Ni] |
| InChI | InChI=1S/C50H84N2.Ni/c1-7-13-19-21-23-29-35-49(51-47-39-43(31-25-15-9-3)37-44(40-47)32-26-16-10-4)50(36-30-24-22-20-14-8-2)52-48-41-45(33-27-17-11-5)38-46(42-48)34-28-18-12-6;/h37-42H,7-36H2,1-6H3;/b51-49+,52-50+; |
| InChIKey | MIASKRVCXDFBDO-CTRXCGSESA-N |
| XLogP | 16.96 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 771.93 |
| LogP ≤ 5 | 16.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|