C34H52N2Pd — CID 87876553
5-N,6-N-bis(3,5-dipropylphenyl)decane-5,6-diimine;palladium (PubChem CID 87876553) has the molecular formula C34H52N2Pd and a molecular weight of 595.22 g/mol. Its IUPAC name is 5-N,6-N-bis(3,5-dipropylphenyl)decane-5,6-diimine;palladium.
| Compound Name | 5-N,6-N-bis(3,5-dipropylphenyl)decane-5,6-diimine;palladium |
|---|---|
| PubChem CID | 87876553 |
| Molecular Formula | C34H52N2Pd |
| Molecular Weight | 595.22 g/mol |
| Exact Mass | 594.32 |
| IUPAC Name | 5-N,6-N-bis(3,5-dipropylphenyl)decane-5,6-diimine;palladium |
| SMILES | CCCCC(=N\c1cc(CCC)cc(CCC)c1)/C(CCCC)=N/c1cc(CCC)cc(CCC)c1.[Pd] |
| InChI | InChI=1S/C34H52N2.Pd/c1-7-13-19-33(35-31-23-27(15-9-3)21-28(24-31)16-10-4)34(20-14-8-2)36-32-25-29(17-11-5)22-30(26-32)18-12-6;/h21-26H,7-20H2,1-6H3;/b35-33+,36-34+; |
| InChIKey | QSAOKHVXKXNTIX-KCINWWGPSA-N |
| XLogP | 10.72 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.22 |
| LogP ≤ 5 | 10.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|