C28H40N2 — CID 87874647
3-N,4-N-bis(3,5-diethylphenyl)octane-3,4-diimine (PubChem CID 87874647) has the molecular formula C28H40N2 and a molecular weight of 404.64 g/mol. Its IUPAC name is 3-N,4-N-bis(3,5-diethylphenyl)octane-3,4-diimine.
| Compound Name | 3-N,4-N-bis(3,5-diethylphenyl)octane-3,4-diimine |
|---|---|
| PubChem CID | 87874647 |
| Molecular Formula | C28H40N2 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.32 |
| IUPAC Name | 3-N,4-N-bis(3,5-diethylphenyl)octane-3,4-diimine |
| SMILES | CCCCC(=N\c1cc(CC)cc(CC)c1)/C(CC)=N/c1cc(CC)cc(CC)c1 |
| InChI | InChI=1S/C28H40N2/c1-7-13-14-28(30-26-19-23(10-4)16-24(11-5)20-26)27(12-6)29-25-17-21(8-2)15-22(9-3)18-25/h15-20H,7-14H2,1-6H3/b29-27+,30-28+ |
| InChIKey | VLGMXYHMJHFKSA-QAVVBOBSSA-N |
| XLogP | 8.38 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 8.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|