C28H40N2 — CID 87911478
6-N-(3,5-dipropylphenyl)-5-N-phenyldecane-5,6-diimine (PubChem CID 87911478) has the molecular formula C28H40N2 and a molecular weight of 404.64 g/mol. Its IUPAC name is 6-N-(3,5-dipropylphenyl)-5-N-phenyldecane-5,6-diimine.
| Compound Name | 6-N-(3,5-dipropylphenyl)-5-N-phenyldecane-5,6-diimine |
|---|---|
| PubChem CID | 87911478 |
| Molecular Formula | C28H40N2 |
| Molecular Weight | 404.64 g/mol |
| Exact Mass | 404.32 |
| IUPAC Name | 6-N-(3,5-dipropylphenyl)-5-N-phenyldecane-5,6-diimine |
| SMILES | CCCCC(=N\c1ccccc1)/C(CCCC)=N/c1cc(CCC)cc(CCC)c1 |
| InChI | InChI=1S/C28H40N2/c1-5-9-18-27(29-25-16-12-11-13-17-25)28(19-10-6-2)30-26-21-23(14-7-3)20-24(22-26)15-8-4/h11-13,16-17,20-22H,5-10,14-15,18-19H2,1-4H3/b29-27+,30-28+ |
| InChIKey | LIOFGMKAHZOMBQ-QAVVBOBSSA-N |
| XLogP | 8.82 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.64 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|