C46H76N2 — CID 21033461
9-N,10-N-bis(3,5-dibutylphenyl)octadecane-9,10-diimine (PubChem CID 21033461) has the molecular formula C46H76N2 and a molecular weight of 657.13 g/mol. Its IUPAC name is 9-N,10-N-bis(3,5-dibutylphenyl)octadecane-9,10-diimine.
| Compound Name | 9-N,10-N-bis(3,5-dibutylphenyl)octadecane-9,10-diimine |
|---|---|
| PubChem CID | 21033461 |
| Molecular Formula | C46H76N2 |
| Molecular Weight | 657.13 g/mol |
| Exact Mass | 656.60 |
| IUPAC Name | 9-N,10-N-bis(3,5-dibutylphenyl)octadecane-9,10-diimine |
| SMILES | CCCCCCCCC(=N\c1cc(CCCC)cc(CCCC)c1)/C(CCCCCCCC)=N/c1cc(CCCC)cc(CCCC)c1 |
| InChI | InChI=1S/C46H76N2/c1-7-13-19-21-23-25-31-45(47-43-35-39(27-15-9-3)33-40(36-43)28-16-10-4)46(32-26-24-22-20-14-8-2)48-44-37-41(29-17-11-5)34-42(38-44)30-18-12-6/h33-38H,7-32H2,1-6H3/b47-45+,48-46+ |
| InChIKey | BUHQNTXVGDGMPM-MLGMXDONSA-N |
| XLogP | 15.40 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.13 |
| LogP ≤ 5 | 15.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|