C25H34N2 — CID 21033543
3-N,4-N-bis(3,5-dimethylphenyl)nonane-3,4-diimine (PubChem CID 21033543) has the molecular formula C25H34N2 and a molecular weight of 362.56 g/mol. Its IUPAC name is 3-N,4-N-bis(3,5-dimethylphenyl)nonane-3,4-diimine.
| Compound Name | 3-N,4-N-bis(3,5-dimethylphenyl)nonane-3,4-diimine |
|---|---|
| PubChem CID | 21033543 |
| Molecular Formula | C25H34N2 |
| Molecular Weight | 362.56 g/mol |
| Exact Mass | 362.27 |
| IUPAC Name | 3-N,4-N-bis(3,5-dimethylphenyl)nonane-3,4-diimine |
| SMILES | CCCCCC(=N\c1cc(C)cc(C)c1)/C(CC)=N/c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C25H34N2/c1-7-9-10-11-25(27-23-16-20(5)13-21(6)17-23)24(8-2)26-22-14-18(3)12-19(4)15-22/h12-17H,7-11H2,1-6H3/b26-24+,27-25+ |
| InChIKey | WDQNYIBCLQANSQ-OWUYFMIJSA-N |
| XLogP | 7.76 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.56 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|