C27H36N2 — CID 87912225
(Z)-4-N,5-N-bis(3,5-dimethylphenyl)undec-2-ene-4,5-diimine (PubChem CID 87912225) has the molecular formula C27H36N2 and a molecular weight of 388.60 g/mol. Its IUPAC name is (Z)-4-N,5-N-bis(3,5-dimethylphenyl)undec-2-ene-4,5-diimine.
| Compound Name | (Z)-4-N,5-N-bis(3,5-dimethylphenyl)undec-2-ene-4,5-diimine |
|---|---|
| PubChem CID | 87912225 |
| Molecular Formula | C27H36N2 |
| Molecular Weight | 388.60 g/mol |
| Exact Mass | 388.29 |
| IUPAC Name | (Z)-4-N,5-N-bis(3,5-dimethylphenyl)undec-2-ene-4,5-diimine |
| SMILES | C/C=C\C(=N/c1cc(C)cc(C)c1)\C(CCCCCC)=N\c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C27H36N2/c1-7-9-10-11-13-27(29-25-18-22(5)15-23(6)19-25)26(12-8-2)28-24-16-20(3)14-21(4)17-24/h8,12,14-19H,7,9-11,13H2,1-6H3/b12-8-,28-26+,29-27+ |
| InChIKey | KWNIMWPAINXINV-YYDKOHKFSA-N |
| XLogP | 8.31 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.60 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|