C23H28N2Ni — CID 87911857
(Z)-4-N,5-N-diphenylundec-2-ene-4,5-diimine;nickel (PubChem CID 87911857) has the molecular formula C23H28N2Ni and a molecular weight of 391.18 g/mol. Its IUPAC name is (Z)-4-N,5-N-diphenylundec-2-ene-4,5-diimine;nickel.
| Compound Name | (Z)-4-N,5-N-diphenylundec-2-ene-4,5-diimine;nickel |
|---|---|
| PubChem CID | 87911857 |
| Molecular Formula | C23H28N2Ni |
| Molecular Weight | 391.18 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | (Z)-4-N,5-N-diphenylundec-2-ene-4,5-diimine;nickel |
| SMILES | C/C=C\C(=N/c1ccccc1)\C(CCCCCC)=N\c1ccccc1.[Ni] |
| InChI | InChI=1S/C23H28N2.Ni/c1-3-5-6-13-19-23(25-21-17-11-8-12-18-21)22(14-4-2)24-20-15-9-7-10-16-20;/h4,7-12,14-18H,3,5-6,13,19H2,1-2H3;/b14-4-,24-22+,25-23+; |
| InChIKey | OIBPQRXDESOJPE-ASOPHCEKSA-N |
| XLogP | 7.08 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.18 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|