C24H30N2Ni — CID 173191426
6-N,7-N-diphenyldodec-4-ene-6,7-diimine;nickel (PubChem CID 173191426) has the molecular formula C24H30N2Ni and a molecular weight of 405.21 g/mol. Its IUPAC name is 6-N,7-N-diphenyldodec-4-ene-6,7-diimine;nickel.
| Compound Name | 6-N,7-N-diphenyldodec-4-ene-6,7-diimine;nickel |
|---|---|
| PubChem CID | 173191426 |
| Molecular Formula | C24H30N2Ni |
| Molecular Weight | 405.21 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | 6-N,7-N-diphenyldodec-4-ene-6,7-diimine;nickel |
| SMILES | CCCC=CC(=N\c1ccccc1)/C(CCCCC)=N/c1ccccc1.[Ni] |
| InChI | InChI=1S/C24H30N2.Ni/c1-3-5-9-19-23(25-21-15-11-7-12-16-21)24(20-10-6-4-2)26-22-17-13-8-14-18-22;/h7-9,11-19H,3-6,10,20H2,1-2H3;/b19-9?,25-23+,26-24+; |
| InChIKey | KEZSMMCZJHBTSY-DADKIKMUSA-N |
| XLogP | 7.47 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.21 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|