C35H52N2Ni — CID 87910916
5-N-(3,4-dipropylphenyl)-6-N-phenylheptadec-7-ene-5,6-diimine;nickel (PubChem CID 87910916) has the molecular formula C35H52N2Ni and a molecular weight of 559.51 g/mol. Its IUPAC name is 5-N-(3,4-dipropylphenyl)-6-N-phenylheptadec-7-ene-5,6-diimine;nickel.
| Compound Name | 5-N-(3,4-dipropylphenyl)-6-N-phenylheptadec-7-ene-5,6-diimine;nickel |
|---|---|
| PubChem CID | 87910916 |
| Molecular Formula | C35H52N2Ni |
| Molecular Weight | 559.51 g/mol |
| Exact Mass | 558.35 |
| IUPAC Name | 5-N-(3,4-dipropylphenyl)-6-N-phenylheptadec-7-ene-5,6-diimine;nickel |
| SMILES | CCCCCCCCCC=CC(=N\c1ccccc1)/C(CCCC)=N/c1ccc(CCC)c(CCC)c1.[Ni] |
| InChI | InChI=1S/C35H52N2.Ni/c1-5-9-11-12-13-14-15-16-20-26-35(36-32-23-18-17-19-24-32)34(25-10-6-2)37-33-28-27-30(21-7-3)31(29-33)22-8-4;/h17-20,23-24,26-29H,5-16,21-22,25H2,1-4H3;/b26-20?,36-35+,37-34+; |
| InChIKey | KHRGLTZYZFMTAM-GLAQOAASSA-N |
| XLogP | 11.32 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.51 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|