C45H72N2Ni — CID 87910696
5-N-(3,4-dibutylphenyl)-6-N-(3,5-dipentylphenyl)pentadec-7-ene-5,6-diimine;nickel (PubChem CID 87910696) has the molecular formula C45H72N2Ni and a molecular weight of 699.78 g/mol. Its IUPAC name is 5-N-(3,4-dibutylphenyl)-6-N-(3,5-dipentylphenyl)pentadec-7-ene-5,6-diimine;nickel.
| Compound Name | 5-N-(3,4-dibutylphenyl)-6-N-(3,5-dipentylphenyl)pentadec-7-ene-5,6-diimine;nickel |
|---|---|
| PubChem CID | 87910696 |
| Molecular Formula | C45H72N2Ni |
| Molecular Weight | 699.78 g/mol |
| Exact Mass | 698.50 |
| IUPAC Name | 5-N-(3,4-dibutylphenyl)-6-N-(3,5-dipentylphenyl)pentadec-7-ene-5,6-diimine;nickel |
| SMILES | CCCCCCCC=CC(=N\c1cc(CCCCC)cc(CCCCC)c1)/C(CCCC)=N/c1ccc(CCCC)c(CCCC)c1.[Ni] |
| InChI | InChI=1S/C45H72N2.Ni/c1-7-13-19-20-21-22-25-31-45(47-43-35-38(26-23-14-8-2)34-39(36-43)27-24-15-9-3)44(30-18-12-6)46-42-33-32-40(28-16-10-4)41(37-42)29-17-11-5;/h25,31-37H,7-24,26-30H2,1-6H3;/b31-25?,46-44+,47-45+; |
| InChIKey | JOJOYWARSJPMHS-BDGFPXFRSA-N |
| XLogP | 14.79 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.78 |
| LogP ≤ 5 | 14.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|