C44H70N2Pd — CID 87912507
(E)-3-N,4-N-bis(3,5-dibutylphenyl)hexadec-5-ene-3,4-diimine;palladium (PubChem CID 87912507) has the molecular formula C44H70N2Pd and a molecular weight of 733.48 g/mol. Its IUPAC name is (E)-3-N,4-N-bis(3,5-dibutylphenyl)hexadec-5-ene-3,4-diimine;palladium.
| Compound Name | (E)-3-N,4-N-bis(3,5-dibutylphenyl)hexadec-5-ene-3,4-diimine;palladium |
|---|---|
| PubChem CID | 87912507 |
| Molecular Formula | C44H70N2Pd |
| Molecular Weight | 733.48 g/mol |
| Exact Mass | 732.46 |
| IUPAC Name | (E)-3-N,4-N-bis(3,5-dibutylphenyl)hexadec-5-ene-3,4-diimine;palladium |
| SMILES | CCCCCCCCCC/C=C/C(=N\c1cc(CCCC)cc(CCCC)c1)/C(CC)=N/c1cc(CCCC)cc(CCCC)c1.[Pd] |
| InChI | InChI=1S/C44H70N2.Pd/c1-7-13-18-19-20-21-22-23-24-25-30-44(46-42-35-39(28-16-10-4)32-40(36-42)29-17-11-5)43(12-6)45-41-33-37(26-14-8-2)31-38(34-41)27-15-9-3;/h25,30-36H,7-24,26-29H2,1-6H3;/b30-25+,45-43+,46-44+; |
| InChIKey | QCJSTQKRBHZXGO-GLWOMAGHSA-N |
| XLogP | 14.40 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.48 |
| LogP ≤ 5 | 14.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|