C53H84N2 — CID 91359158
9-N,10-N-bis(3,5-dipentylphenyl)henicos-11-en-7-yne-9,10-diimine (PubChem CID 91359158) has the molecular formula C53H84N2 and a molecular weight of 749.27 g/mol. Its IUPAC name is 9-N,10-N-bis(3,5-dipentylphenyl)henicos-11-en-7-yne-9,10-diimine.
| Compound Name | 9-N,10-N-bis(3,5-dipentylphenyl)henicos-11-en-7-yne-9,10-diimine |
|---|---|
| PubChem CID | 91359158 |
| Molecular Formula | C53H84N2 |
| Molecular Weight | 749.27 g/mol |
| Exact Mass | 748.66 |
| IUPAC Name | 9-N,10-N-bis(3,5-dipentylphenyl)henicos-11-en-7-yne-9,10-diimine |
| SMILES | CCCCCCC#CC(=N\c1cc(CCCCC)cc(CCCCC)c1)/C(C=CCCCCCCCCC)=N/c1cc(CCCCC)cc(CCCCC)c1 |
| InChI | InChI=1S/C53H84N2/c1-7-13-19-21-23-24-25-27-33-39-53(55-51-44-48(36-30-17-11-5)41-49(45-51)37-31-18-12-6)52(38-32-26-22-20-14-8-2)54-50-42-46(34-28-15-9-3)40-47(43-50)35-29-16-10-4/h33,39-45H,7-31,34-37H2,1-6H3/b39-33?,54-52+,55-53+ |
| InChIKey | LBNIGUOUNSAZFO-ZHJINWAISA-N |
| XLogP | 17.13 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 32 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 749.27 |
| LogP ≤ 5 | 17.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|