C36H54N2 — CID 87911066
(E)-7-N-(3,5-diethylphenyl)-8-N-phenylicos-9-ene-7,8-diimine (PubChem CID 87911066) has the molecular formula C36H54N2 and a molecular weight of 514.84 g/mol. Its IUPAC name is (E)-7-N-(3,5-diethylphenyl)-8-N-phenylicos-9-ene-7,8-diimine.
| Compound Name | (E)-7-N-(3,5-diethylphenyl)-8-N-phenylicos-9-ene-7,8-diimine |
|---|---|
| PubChem CID | 87911066 |
| Molecular Formula | C36H54N2 |
| Molecular Weight | 514.84 g/mol |
| Exact Mass | 514.43 |
| IUPAC Name | (E)-7-N-(3,5-diethylphenyl)-8-N-phenylicos-9-ene-7,8-diimine |
| SMILES | CCCCCCCCCC/C=C/C(=N\c1ccccc1)/C(CCCCCC)=N/c1cc(CC)cc(CC)c1 |
| InChI | InChI=1S/C36H54N2/c1-5-9-11-13-14-15-16-17-18-23-27-35(37-33-24-20-19-21-25-33)36(26-22-12-10-6-2)38-34-29-31(7-3)28-32(8-4)30-34/h19-21,23-25,27-30H,5-18,22,26H2,1-4H3/b27-23+,37-35+,38-36+ |
| InChIKey | SBJQSDKUBIPBAK-BBAKQSIQSA-N |
| XLogP | 11.71 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.84 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|