C25H30N2Ni — CID 87876795
5-N,6-N-diphenyltridec-7-yne-5,6-diimine;nickel (PubChem CID 87876795) has the molecular formula C25H30N2Ni and a molecular weight of 417.22 g/mol. Its IUPAC name is 5-N,6-N-diphenyltridec-7-yne-5,6-diimine;nickel.
| Compound Name | 5-N,6-N-diphenyltridec-7-yne-5,6-diimine;nickel |
|---|---|
| PubChem CID | 87876795 |
| Molecular Formula | C25H30N2Ni |
| Molecular Weight | 417.22 g/mol |
| Exact Mass | 416.18 |
| IUPAC Name | 5-N,6-N-diphenyltridec-7-yne-5,6-diimine;nickel |
| SMILES | CCCCCC#CC(=N\c1ccccc1)/C(CCCC)=N/c1ccccc1.[Ni] |
| InChI | InChI=1S/C25H30N2.Ni/c1-3-5-7-8-15-21-25(27-23-18-13-10-14-19-23)24(20-6-4-2)26-22-16-11-9-12-17-22;/h9-14,16-19H,3-8,20H2,1-2H3;/b26-24+,27-25+; |
| InChIKey | QFNRWKCHOIWKJL-PQZHMVGGSA-N |
| XLogP | 7.30 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.22 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|