C15H22O2S2 — CID 11243478
[(Z)-4,4-diethoxy-2-methylsulfanylbut-1-enyl]sulfanylbenzene (PubChem CID 11243478) has the molecular formula C15H22O2S2 and a molecular weight of 298.47 g/mol. Its IUPAC name is [(Z)-4,4-diethoxy-2-methylsulfanylbut-1-enyl]sulfanylbenzene.
| Compound Name | [(Z)-4,4-diethoxy-2-methylsulfanylbut-1-enyl]sulfanylbenzene |
|---|---|
| PubChem CID | 11243478 |
| Molecular Formula | C15H22O2S2 |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | [(Z)-4,4-diethoxy-2-methylsulfanylbut-1-enyl]sulfanylbenzene |
| SMILES | CCOC(C/C(=C/Sc1ccccc1)SC)OCC |
| InChI | InChI=1S/C15H22O2S2/c1-4-16-15(17-5-2)11-14(18-3)12-19-13-9-7-6-8-10-13/h6-10,12,15H,4-5,11H2,1-3H3/b14-12- |
| InChIKey | BFWKIMKPEQCWEP-OWBHPGMISA-N |
| XLogP | 4.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|