C36H48O5S6 — CID 174825274
2-(2,2-diethoxyethyldisulfanyl)-1,1-diethoxyethane;bis((phenyldisulfanyl)benzene);hydrate (PubChem CID 174825274) has the molecular formula C36H48O5S6 and a molecular weight of 753.18 g/mol. Its IUPAC name is 2-(2,2-diethoxyethyldisulfanyl)-1,1-diethoxyethane;bis((phenyldisulfanyl)benzene);hydrate.
| Compound Name | 2-(2,2-diethoxyethyldisulfanyl)-1,1-diethoxyethane;bis((phenyldisulfanyl)benzene);hydrate |
|---|---|
| PubChem CID | 174825274 |
| Molecular Formula | C36H48O5S6 |
| Molecular Weight | 753.18 g/mol |
| Exact Mass | 752.18 |
| IUPAC Name | 2-(2,2-diethoxyethyldisulfanyl)-1,1-diethoxyethane;bis((phenyldisulfanyl)benzene);hydrate |
| SMILES | CCOC(CSSCC(OCC)OCC)OCC.O.c1ccc(SSc2ccccc2)cc1.c1ccc(SSc2ccccc2)cc1 |
| InChI | InChI=1S/C12H26O4S2.2C12H10S2.H2O/c1-5-13-11(14-6-2)9-17-18-10-12(15-7-3)16-8-4;2*1-3-7-11(8-4-1)13-14-12-9-5-2-6-10-12;/h11-12H,5-10H2,1-4H3;2*1-10H;1H2 |
| InChIKey | ZPDKXTDYTLADSJ-UHFFFAOYSA-N |
| XLogP | 11.31 |
| TPSA | 68.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 753.18 |
| LogP ≤ 5 | 11.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|