C13H20O3S — CID 10106471
1-(2,2-diethoxyethylsulfanyl)-2-methoxybenzene (PubChem CID 10106471) has the molecular formula C13H20O3S and a molecular weight of 256.37 g/mol. Its IUPAC name is 1-(2,2-diethoxyethylsulfanyl)-2-methoxybenzene.
| Compound Name | 1-(2,2-diethoxyethylsulfanyl)-2-methoxybenzene |
|---|---|
| PubChem CID | 10106471 |
| Molecular Formula | C13H20O3S |
| Molecular Weight | 256.37 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 1-(2,2-diethoxyethylsulfanyl)-2-methoxybenzene |
| SMILES | CCOC(CSc1ccccc1OC)OCC |
| InChI | InChI=1S/C13H20O3S/c1-4-15-13(16-5-2)10-17-12-9-7-6-8-11(12)14-3/h6-9,13H,4-5,10H2,1-3H3 |
| InChIKey | QXTSFEBXASFTLV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|