C12H19O2PS — CID 154117287
2,2-diethoxyethyl(phenylsulfanyl)phosphane (PubChem CID 154117287) has the molecular formula C12H19O2PS and a molecular weight of 258.32 g/mol. Its IUPAC name is 2,2-diethoxyethyl(phenylsulfanyl)phosphane.
| Compound Name | 2,2-diethoxyethyl(phenylsulfanyl)phosphane |
|---|---|
| PubChem CID | 154117287 |
| Molecular Formula | C12H19O2PS |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 2,2-diethoxyethyl(phenylsulfanyl)phosphane |
| SMILES | CCOC(CPSc1ccccc1)OCC |
| InChI | InChI=1S/C12H19O2PS/c1-3-13-12(14-4-2)10-15-16-11-8-6-5-7-9-11/h5-9,12,15H,3-4,10H2,1-2H3 |
| InChIKey | KGWNZFVBBWCYPC-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|