About bis(phenylsulfanyl)phosphane;ethanol
bis(phenylsulfanyl)phosphane;ethanol (PubChem CID 142939006) has the molecular formula C14H17OPS2
and a molecular weight of 296.40 g/mol. Its IUPAC name is bis(phenylsulfanyl)phosphane;ethanol.
Molecular Properties
| Compound Name | bis(phenylsulfanyl)phosphane;ethanol |
| PubChem CID | 142939006 |
| Molecular Formula | C14H17OPS2 |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | bis(phenylsulfanyl)phosphane;ethanol |
| SMILES | CCO.c1ccc(SPSc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11PS2.C2H6O/c1-3-7-11(8-4-1)14-13-15-12-9-5-2-6-10-12;1-2-3/h1-10,13H;3H,2H2,1H3 |
| InChIKey | AVCOGNDURURNAQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.40 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bis(phenylsulfanyl)phosphane;ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(phenylsulfanyl)phosphane;ethanol?
The IUPAC name of bis(phenylsulfanyl)phosphane;ethanol (CID 142939006) is bis(phenylsulfanyl)phosphane;ethanol.
What is the SMILES notation for bis(phenylsulfanyl)phosphane;ethanol?
The canonical SMILES for bis(phenylsulfanyl)phosphane;ethanol is CCO.c1ccc(SPSc2ccccc2)cc1.
What is the InChIKey of bis(phenylsulfanyl)phosphane;ethanol?
The InChIKey is AVCOGNDURURNAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11PS2.C2H6O/c1-3-7-11(8-4-1)14-13-15-12-9-5-2-6-10-12;1-2-3/h1-10,13H;3H,2H2,1H3.
What are the key properties of bis(phenylsulfanyl)phosphane;ethanol?
bis(phenylsulfanyl)phosphane;ethanol has a molecular weight of 296.40 g/mol, XLogP of 5.08, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for bis(phenylsulfanyl)phosphane;ethanol is sourced from PubChem (CID 142939006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).