C22H26OS2 — CID 171377896
(1Z)-3,7-dimethyl-1,2-bis(phenylsulfanyl)octa-1,6-dien-3-ol (PubChem CID 171377896) has the molecular formula C22H26OS2 and a molecular weight of 370.58 g/mol. Its IUPAC name is (1Z)-3,7-dimethyl-1,2-bis(phenylsulfanyl)octa-1,6-dien-3-ol.
| Compound Name | (1Z)-3,7-dimethyl-1,2-bis(phenylsulfanyl)octa-1,6-dien-3-ol |
|---|---|
| PubChem CID | 171377896 |
| Molecular Formula | C22H26OS2 |
| Molecular Weight | 370.58 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (1Z)-3,7-dimethyl-1,2-bis(phenylsulfanyl)octa-1,6-dien-3-ol |
| SMILES | CC(C)=CCCC(C)(O)/C(=C/Sc1ccccc1)Sc1ccccc1 |
| InChI | InChI=1S/C22H26OS2/c1-18(2)11-10-16-22(3,23)21(25-20-14-8-5-9-15-20)17-24-19-12-6-4-7-13-19/h4-9,11-15,17,23H,10,16H2,1-3H3/b21-17- |
| InChIKey | CMGJRTLPAJZJTJ-FXBPSFAMSA-N |
| XLogP | 6.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.58 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|