C20H26O4 — CID 54763763
[1-[(1R,2S)-2-acetyloxy-2-phenylcyclopropyl]-2-methylprop-1-enyl] 2,2-dimethylpropanoate (PubChem CID 54763763) has the molecular formula C20H26O4 and a molecular weight of 330.42 g/mol. Its IUPAC name is [1-[(1R,2S)-2-acetyloxy-2-phenylcyclopropyl]-2-methylprop-1-enyl] 2,2-dimethylpropanoate.
| Compound Name | [1-[(1R,2S)-2-acetyloxy-2-phenylcyclopropyl]-2-methylprop-1-enyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 54763763 |
| Molecular Formula | C20H26O4 |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | [1-[(1R,2S)-2-acetyloxy-2-phenylcyclopropyl]-2-methylprop-1-enyl] 2,2-dimethylpropanoate |
| SMILES | CC(=O)O[C@@]1(c2ccccc2)C[C@@H]1C(OC(=O)C(C)(C)C)=C(C)C |
| InChI | InChI=1S/C20H26O4/c1-13(2)17(23-18(22)19(4,5)6)16-12-20(16,24-14(3)21)15-10-8-7-9-11-15/h7-11,16H,12H2,1-6H3/t16-,20-/m1/s1 |
| InChIKey | AEIOYNSRJAYFIB-OXQOHEQNSA-N |
| XLogP | 4.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|