C18H28NO2+ — CID 6922097
[(3R,5S)-1-tert-butyl-5-methyl-3-phenylpiperidin-1-ium-3-yl] acetate (PubChem CID 6922097) has the molecular formula C18H28NO2+ and a molecular weight of 290.43 g/mol. Its IUPAC name is [(3R,5S)-1-tert-butyl-5-methyl-3-phenylpiperidin-1-ium-3-yl] acetate.
| Compound Name | [(3R,5S)-1-tert-butyl-5-methyl-3-phenylpiperidin-1-ium-3-yl] acetate |
|---|---|
| PubChem CID | 6922097 |
| Molecular Formula | C18H28NO2+ |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | [(3R,5S)-1-tert-butyl-5-methyl-3-phenylpiperidin-1-ium-3-yl] acetate |
| SMILES | CC(=O)O[C@@]1(c2ccccc2)C[C@H](C)C[NH+](C(C)(C)C)C1 |
| InChI | InChI=1S/C18H27NO2/c1-14-11-18(21-15(2)20,16-9-7-6-8-10-16)13-19(12-14)17(3,4)5/h6-10,14H,11-13H2,1-5H3/p+1/t14-,18-/m0/s1 |
| InChIKey | CBBJQWWDAAESRN-KSSFIOAISA-O |
| XLogP | 2.17 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |