C27H38N2O+2 — CID 7317113
3,7-ditert-butyl-1,5-diphenyl-3,7-diazoniabicyclo[3.3.1]nonan-9-one (PubChem CID 7317113) has the molecular formula C27H38N2O+2 and a molecular weight of 406.61 g/mol. Its IUPAC name is 3,7-ditert-butyl-1,5-diphenyl-3,7-diazoniabicyclo[3.3.1]nonan-9-one.
| Compound Name | 3,7-ditert-butyl-1,5-diphenyl-3,7-diazoniabicyclo[3.3.1]nonan-9-one |
|---|---|
| PubChem CID | 7317113 |
| Molecular Formula | C27H38N2O+2 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.30 |
| IUPAC Name | 3,7-ditert-butyl-1,5-diphenyl-3,7-diazoniabicyclo[3.3.1]nonan-9-one |
| SMILES | CC(C)(C)[NH+]1CC2(c3ccccc3)C[NH+](C(C)(C)C)CC(c3ccccc3)(C1)C2=O |
| InChI | InChI=1S/C27H36N2O/c1-24(2,3)28-17-26(21-13-9-7-10-14-21)19-29(25(4,5)6)20-27(18-28,23(26)30)22-15-11-8-12-16-22/h7-16H,17-20H2,1-6H3/p+2 |
| InChIKey | AGGRFNRAFABJFX-UHFFFAOYSA-P |
| XLogP | 1.83 |
| TPSA | 25.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |