C21H24N2O3+2 — CID 7453312
2-(2,4-dihydroxyphenyl)-5-methyl-7-phenyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one (PubChem CID 7453312) has the molecular formula C21H24N2O3+2 and a molecular weight of 352.43 g/mol. Its IUPAC name is 2-(2,4-dihydroxyphenyl)-5-methyl-7-phenyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one.
| Compound Name | 2-(2,4-dihydroxyphenyl)-5-methyl-7-phenyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one |
|---|---|
| PubChem CID | 7453312 |
| Molecular Formula | C21H24N2O3+2 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 2-(2,4-dihydroxyphenyl)-5-methyl-7-phenyl-1,3-diazoniatricyclo[3.3.1.13,7]decan-6-one |
| SMILES | CC12C[NH+]3CC(c4ccccc4)(C[NH+](C1)C3c1ccc(O)cc1O)C2=O |
| InChI | InChI=1S/C21H22N2O3/c1-20-10-22-12-21(19(20)26,14-5-3-2-4-6-14)13-23(11-20)18(22)16-8-7-15(24)9-17(16)25/h2-9,18,24-25H,10-13H2,1H3/p+2 |
| InChIKey | OZXHCCZILOOEOM-UHFFFAOYSA-P |
| XLogP | -0.58 |
| TPSA | 66.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|