C24H24O3 — CID 142700630
2-[4,4-bis(4-hydroxyphenyl)cyclohexyl]phenol (PubChem CID 142700630) has the molecular formula C24H24O3 and a molecular weight of 360.45 g/mol. Its IUPAC name is 2-[4,4-bis(4-hydroxyphenyl)cyclohexyl]phenol.
| Compound Name | 2-[4,4-bis(4-hydroxyphenyl)cyclohexyl]phenol |
|---|---|
| PubChem CID | 142700630 |
| Molecular Formula | C24H24O3 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 2-[4,4-bis(4-hydroxyphenyl)cyclohexyl]phenol |
| SMILES | Oc1ccc(C2(c3ccc(O)cc3)CCC(c3ccccc3O)CC2)cc1 |
| InChI | InChI=1S/C24H24O3/c25-20-9-5-18(6-10-20)24(19-7-11-21(26)12-8-19)15-13-17(14-16-24)22-3-1-2-4-23(22)27/h1-12,17,25-27H,13-16H2 |
| InChIKey | GCPSFAPATOJVFW-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |