C21H34NO2+ — CID 7124613
[(3S,5S)-1,5-ditert-butyl-3-phenylpiperidin-1-ium-3-yl] acetate (PubChem CID 7124613) has the molecular formula C21H34NO2+ and a molecular weight of 332.51 g/mol. Its IUPAC name is [(3S,5S)-1,5-ditert-butyl-3-phenylpiperidin-1-ium-3-yl] acetate.
| Compound Name | [(3S,5S)-1,5-ditert-butyl-3-phenylpiperidin-1-ium-3-yl] acetate |
|---|---|
| PubChem CID | 7124613 |
| Molecular Formula | C21H34NO2+ |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.26 |
| IUPAC Name | [(3S,5S)-1,5-ditert-butyl-3-phenylpiperidin-1-ium-3-yl] acetate |
| SMILES | CC(=O)O[C@]1(c2ccccc2)C[C@@H](C(C)(C)C)C[NH+](C(C)(C)C)C1 |
| InChI | InChI=1S/C21H33NO2/c1-16(23)24-21(17-11-9-8-10-12-17)13-18(19(2,3)4)14-22(15-21)20(5,6)7/h8-12,18H,13-15H2,1-7H3/p+1/t18-,21-/m1/s1 |
| InChIKey | XENZICQEFWMILM-WIYYLYMNSA-O |
| XLogP | 3.19 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |