C19H26O4 — CID 23252765
2-(4-tert-butyl-1-phenylcyclohexyl)propanedioic acid (PubChem CID 23252765) has the molecular formula C19H26O4 and a molecular weight of 318.41 g/mol. Its IUPAC name is 2-(4-tert-butyl-1-phenylcyclohexyl)propanedioic acid.
| Compound Name | 2-(4-tert-butyl-1-phenylcyclohexyl)propanedioic acid |
|---|---|
| PubChem CID | 23252765 |
| Molecular Formula | C19H26O4 |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | 2-(4-tert-butyl-1-phenylcyclohexyl)propanedioic acid |
| SMILES | CC(C)(C)C1CCC(c2ccccc2)(C(C(=O)O)C(=O)O)CC1 |
| InChI | InChI=1S/C19H26O4/c1-18(2,3)13-9-11-19(12-10-13,14-7-5-4-6-8-14)15(16(20)21)17(22)23/h4-8,13,15H,9-12H2,1-3H3,(H,20,21)(H,22,23) |
| InChIKey | QWUYCSKZHXYKMC-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|