C16H24O2 — CID 101134150
(1S,2S,4R)-4-tert-butyl-1-phenylcyclohexane-1,2-diol (PubChem CID 101134150) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (1S,2S,4R)-4-tert-butyl-1-phenylcyclohexane-1,2-diol.
| Compound Name | (1S,2S,4R)-4-tert-butyl-1-phenylcyclohexane-1,2-diol |
|---|---|
| PubChem CID | 101134150 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (1S,2S,4R)-4-tert-butyl-1-phenylcyclohexane-1,2-diol |
| SMILES | CC(C)(C)[C@@H]1CC[C@](O)(c2ccccc2)[C@@H](O)C1 |
| InChI | InChI=1S/C16H24O2/c1-15(2,3)13-9-10-16(18,14(17)11-13)12-7-5-4-6-8-12/h4-8,13-14,17-18H,9-11H2,1-3H3/t13-,14+,16+/m1/s1 |
| InChIKey | IRXRAJHRWGDOTL-YCPHGPKFSA-N |
| XLogP | 3.08 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |