C18H26O4 — CID 141269945
2-[4-[(1R,2R,4R)-4-tert-butyl-1,2-dihydroxycyclohexyl]phenyl]acetic acid (PubChem CID 141269945) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is 2-[4-[(1R,2R,4R)-4-tert-butyl-1,2-dihydroxycyclohexyl]phenyl]acetic acid.
| Compound Name | 2-[4-[(1R,2R,4R)-4-tert-butyl-1,2-dihydroxycyclohexyl]phenyl]acetic acid |
|---|---|
| PubChem CID | 141269945 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-[4-[(1R,2R,4R)-4-tert-butyl-1,2-dihydroxycyclohexyl]phenyl]acetic acid |
| SMILES | CC(C)(C)[C@@H]1CC[C@@](O)(c2ccc(CC(=O)O)cc2)[C@H](O)C1 |
| InChI | InChI=1S/C18H26O4/c1-17(2,3)14-8-9-18(22,15(19)11-14)13-6-4-12(5-7-13)10-16(20)21/h4-7,14-15,19,22H,8-11H2,1-3H3,(H,20,21)/t14-,15-,18-/m1/s1 |
| InChIKey | NPGJZCUHFCVUDW-IIDMSEBBSA-N |
| XLogP | 2.71 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |