C12H22O3 — CID 65095145
4-tert-butyl-1-hydroxycycloheptane-1-carboxylic acid (PubChem CID 65095145) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is 4-tert-butyl-1-hydroxycycloheptane-1-carboxylic acid.
| Compound Name | 4-tert-butyl-1-hydroxycycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 65095145 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 4-tert-butyl-1-hydroxycycloheptane-1-carboxylic acid |
| SMILES | CC(C)(C)C1CCCC(O)(C(=O)O)CC1 |
| InChI | InChI=1S/C12H22O3/c1-11(2,3)9-5-4-7-12(15,8-6-9)10(13)14/h9,15H,4-8H2,1-3H3,(H,13,14) |
| InChIKey | VQHKAHIPTRAEHG-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |