C15H29NO2 — CID 65094580
2-[4-tert-butyl-1-(dimethylamino)cycloheptyl]acetic acid (PubChem CID 65094580) has the molecular formula C15H29NO2 and a molecular weight of 255.40 g/mol. Its IUPAC name is 2-[4-tert-butyl-1-(dimethylamino)cycloheptyl]acetic acid.
| Compound Name | 2-[4-tert-butyl-1-(dimethylamino)cycloheptyl]acetic acid |
|---|---|
| PubChem CID | 65094580 |
| Molecular Formula | C15H29NO2 |
| Molecular Weight | 255.40 g/mol |
| Exact Mass | 255.22 |
| IUPAC Name | 2-[4-tert-butyl-1-(dimethylamino)cycloheptyl]acetic acid |
| SMILES | CN(C)C1(CC(=O)O)CCCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C15H29NO2/c1-14(2,3)12-7-6-9-15(10-8-12,16(4)5)11-13(17)18/h12H,6-11H2,1-5H3,(H,17,18) |
| InChIKey | XSYJJSVVLXIEKQ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.40 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |